ChemNet > CAS > 15690-25-2 3-(2-Thienyl)acrylic acid
15690-25-2 3-(2-Thienyl)acrylic acid
| product Name |
3-(2-Thienyl)acrylic acid |
| CAS No |
15690-25-2 |
| Synonyms |
Thiophene-2-acrylic acid; 3-(2-Thiophenyl)propenoic acid; (2E)-3-thiophen-2-ylprop-2-enoate |
| Molecular Formula |
C7H5O2S |
| Molecular Weight |
153.1789 |
| InChI |
InChI=1/C7H6O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-5H,(H,8,9)/p-1/b4-3+ |
| Molecular Structure |
|
| Melting point |
145-148℃ |
| Boiling point |
298.9°C at 760 mmHg |
| Flash point |
134.6°C |
| Vapour Pressur |
0.000551mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
