1571-86-4 1,4-Di-n-butylbenzene
product Name |
1,4-Di-n-butylbenzene |
CAS No |
1571-86-4 |
Synonyms |
Benzene, 1,4-dibutyl-; 1,4-dibutylbenzene |
Molecular Formula |
C14H22 |
Molecular Weight |
190.3245 |
InChI |
InChI=1/C14H22/c1-3-5-7-13-9-11-14(12-10-13)8-6-4-2/h9-12H,3-8H2,1-2H3 |
Molecular Structure |
|
Density |
0.86g/cm3 |
Boiling point |
263.5°C at 760 mmHg |
Refractive index |
1.489 |
Flash point |
113°C |
Vapour Pressur |
0.0167mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|