ChemNet > CAS > 1572-46-9 9-Benzylfluorene
1572-46-9 9-Benzylfluorene
| product Name |
9-Benzylfluorene |
| CAS No |
1572-46-9 |
| Synonyms |
9-benzyl-9H-fluorene |
| Molecular Formula |
C20H16 |
| Molecular Weight |
256.341 |
| InChI |
InChI=1/C20H16/c1-2-8-15(9-3-1)14-20-18-12-6-4-10-16(18)17-11-5-7-13-19(17)20/h1-13,20H,14H2 |
| Molecular Structure |
|
| Density |
1.131g/cm3 |
| Boiling point |
411.5°C at 760 mmHg |
| Refractive index |
1.652 |
| Flash point |
196.3°C |
| Vapour Pressur |
1.32E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
