ChemNet > CAS > 15804-19-0 2,3-Dihydroxyquinoxaline
15804-19-0 2,3-Dihydroxyquinoxaline
| product Name |
2,3-Dihydroxyquinoxaline |
| CAS No |
15804-19-0 |
| Synonyms |
2,3-Quinoxalinediol; 1,4-Dihydro-2,3-quinoxalinedione; quinoxaline-2,3-diol; 1,4-dihydroquinoxaline-2,3-dione |
| Molecular Formula |
C8H6N2O2 |
| Molecular Weight |
162.1454 |
| InChI |
InChI=1/C8H6N2O2/c11-7-8(12)10-6-4-2-1-3-5(6)9-7/h1-4H,(H,9,11)(H,10,12) |
| EINECS |
239-901-0 |
| Molecular Structure |
|
| Density |
1.517g/cm3 |
| Melting point |
300℃ |
| Boiling point |
470.915°C at 760 mmHg |
| Refractive index |
1.762 |
| Flash point |
238.601°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
