ChemNet > CAS > 1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
1582-24-7 2,3,4,5,6-Pentafluorobenzeneboronic acid
| product Name |
2,3,4,5,6-Pentafluorobenzeneboronic acid |
| CAS No |
1582-24-7 |
| Synonyms |
2,3,4,5,6-Pentafluorophenylboronic acid; Pentafluorophenylboronic acid; (pentafluorophenyl)boronic acid |
| Molecular Formula |
C6H2BF5O2 |
| Molecular Weight |
211.8819 |
| InChI |
InChI=1/C6H2BF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h13-14H |
| Molecular Structure |
|
| Density |
1.61g/cm3 |
| Boiling point |
244°C at 760 mmHg |
| Refractive index |
1.429 |
| Flash point |
101.4°C |
| Vapour Pressur |
0.0166mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
