ChemNet > CAS > 15822-77-2 1-(2-nitrophenyl)piperidine
15822-77-2 1-(2-nitrophenyl)piperidine
| product Name |
1-(2-nitrophenyl)piperidine |
| CAS No |
15822-77-2 |
| Synonyms |
1-(2-Nitrophenyl)piperidine; 1-(O-Nitrophenyl)piperidine; Piperidine, 1-(2-nitrophenyl)- |
| Molecular Formula |
C11H14N2O2 |
| Molecular Weight |
206.2411 |
| InChI |
InChI=1/C11H14N2O2/c14-13(15)11-7-3-2-6-10(11)12-8-4-1-5-9-12/h2-3,6-7H,1,4-5,8-9H2 |
| Molecular Structure |
|
| Density |
1.188g/cm3 |
| Melting point |
77℃ |
| Boiling point |
337.7°C at 760 mmHg |
| Refractive index |
1.578 |
| Flash point |
158°C |
| Vapour Pressur |
0.000103mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
