ChemNet > CAS > 158414-45-0 (1S,2R)-(+)-2-Aminocyclohexanecarboxylic acid hydrochloride
158414-45-0 (1S,2R)-(+)-2-Aminocyclohexanecarboxylic acid hydrochloride
| product Name |
(1S,2R)-(+)-2-Aminocyclohexanecarboxylic acid hydrochloride |
| CAS No |
158414-45-0 |
| Synonyms |
(1S,2R)-2-ammoniocyclohexanecarboxylate |
| Molecular Formula |
C7H13NO2 |
| Molecular Weight |
143.1836 |
| InChI |
InChI=1/C7H13NO2/c8-6-4-2-1-3-5(6)7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6+/m0/s1 |
| Molecular Structure |
|
| Density |
1.133g/cm3 |
| Melting point |
233℃ |
| Boiling point |
280°C at 760 mmHg |
| Refractive index |
1.503 |
| Flash point |
123.1°C |
| Vapour Pressur |
0.00103mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
