ChemNet > CAS > 1586-00-1 2-Benzylbenzyl alcohol
1586-00-1 2-Benzylbenzyl alcohol
| product Name |
2-Benzylbenzyl alcohol |
| CAS No |
1586-00-1 |
| Synonyms |
(2-benzylphenyl)methanol |
| Molecular Formula |
C14H14O |
| Molecular Weight |
198.2604 |
| InChI |
InChI=1/C14H14O/c15-11-14-9-5-4-8-13(14)10-12-6-2-1-3-7-12/h1-9,15H,10-11H2 |
| EINECS |
216-442-4 |
| Molecular Structure |
|
| Density |
1.085g/cm3 |
| Melting point |
37-41℃ |
| Boiling point |
347.2°C at 760 mmHg |
| Refractive index |
1.594 |
| Flash point |
144.3°C |
| Vapour Pressur |
2.06E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
