ChemNet > CAS > 1589-60-2 1-Phenyl-1-cyclohexanol
1589-60-2 1-Phenyl-1-cyclohexanol
| product Name |
1-Phenyl-1-cyclohexanol |
| Synonyms |
1-Phenylcyclohexanol |
| Molecular Formula |
C12H16O |
| Molecular Weight |
176.2548 |
| InChI |
InChI=1/C12H16O/c13-12(9-5-2-6-10-12)11-7-3-1-4-8-11/h1,3-4,7-8,13H,2,5-6,9-10H2 |
| CAS Registry Number |
1589-60-2 |
| EINECS |
216-456-0 |
| Molecular Structure |
|
| Density |
1.061g/cm3 |
| Melting point |
58-62℃ |
| Boiling point |
295.1°C at 760 mmHg |
| Refractive index |
1.558 |
| Flash point |
113.1°C |
| Vapour Pressur |
0.000704mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
1-Phenyl-1-cyclohexanol Material Safety Data Sheet
|
|
