ChemNet > CAS > 15903-94-3 6-benzyloxyindole
15903-94-3 6-benzyloxyindole
| product Name |
6-benzyloxyindole |
| Synonyms |
6-(benzyloxy)-1H-indole |
| Molecular Formula |
C15H13NO |
| Molecular Weight |
223.2698 |
| InChI |
InChI=1/C15H13NO/c1-2-4-12(5-3-1)11-17-14-7-6-13-8-9-16-15(13)10-14/h1-10,16H,11H2 |
| CAS Registry Number |
15903-94-3 |
| Molecular Structure |
|
| Density |
1.196g/cm3 |
| Boiling point |
411.6°C at 760 mmHg |
| Refractive index |
1.669 |
| Flash point |
148.9°C |
| Vapour Pressur |
1.31E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
