ChemNet > CAS > 159275-17-9 benzyl 4-(bromomethyl)tetrahydro-1(2H)-pyridinecarboxylate
159275-17-9 benzyl 4-(bromomethyl)tetrahydro-1(2H)-pyridinecarboxylate
| product Name |
benzyl 4-(bromomethyl)tetrahydro-1(2H)-pyridinecarboxylate |
| CAS No |
159275-17-9 |
| Synonyms |
Benzyl 4-(bromoethyl)tetrahydro-1(2H)-pyridinecarboxylate; benzyl 4-(bromomethyl)piperidine-1-carboxylate; N-(Benzyloxycarbonyl)-4-(bromomethyl)piperidine |
| Molecular Formula |
C14H18BrNO2 |
| Molecular Weight |
312.2022 |
| InChI |
InChI=1/C14H18BrNO2/c15-10-12-6-8-16(9-7-12)14(17)18-11-13-4-2-1-3-5-13/h1-5,12H,6-11H2 |
| Molecular Structure |
|
| Density |
1.356g/cm3 |
| Melting point |
67℃ |
| Boiling point |
403.4°C at 760 mmHg |
| Refractive index |
1.56 |
| Flash point |
197.8°C |
| Vapour Pressur |
1.02E-06mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
