ChemNet > CAS > 1604-28-0 6-Methyl-3,5-heptadien-2-one
1604-28-0 6-Methyl-3,5-heptadien-2-one
| product Name |
6-Methyl-3,5-heptadien-2-one |
| CAS No |
1604-28-0 |
| Synonyms |
3,5-Heptadien-2-one, 6-methyl-; 2-Methylhepta-2,4-dien-6-one; AI3-25071; FEMA No. 3363; Methylheptadienone; 6-Methylhepta-3,5-dien-2-one; (3E)-6-methylhepta-3,5-dien-2-one; (3Z)-6-methylhepta-3,5-dien-2-one |
| Molecular Formula |
C8H12O |
| Molecular Weight |
124.1803 |
| InChI |
InChI=1/C8H12O/c1-7(2)5-4-6-8(3)9/h4-6H,1-3H3/b6-4- |
| EINECS |
216-507-7 |
| Molecular Structure |
|
| Density |
0.858g/cm3 |
| Boiling point |
193.45°C at 760 mmHg |
| Refractive index |
1.453 |
| Flash point |
68.582°C |
| Vapour Pressur |
0.464mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
