ChemNet > CAS > 1608-51-1 4-Fluorochalcone
1608-51-1 4-Fluorochalcone
| product Name |
4-Fluorochalcone |
| CAS No |
1608-51-1 |
| Synonyms |
1-Phenyl-3-(4-fluorophenyl)-2-propen-1-one; 4-Fluorobenzylideneacetophenone; 3-(4-fluorophenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-fluorophenyl)-1-phenylprop-2-en-1-one |
| Molecular Formula |
C15H11FO |
| Molecular Weight |
226.2456 |
| InChI |
InChI=1/C15H11FO/c16-14-9-6-12(7-10-14)8-11-15(17)13-4-2-1-3-5-13/h1-11H/b11-8+ |
| Molecular Structure |
|
| Density |
1.166g/cm3 |
| Melting point |
84℃ |
| Boiling point |
345.9°C at 760 mmHg |
| Refractive index |
1.608 |
| Flash point |
157.3°C |
| Vapour Pressur |
5.97E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
