ChemNet > CAS > 16152-51-5 4-Isopropylbenzeneboronic acid
16152-51-5 4-Isopropylbenzeneboronic acid
| product Name |
4-Isopropylbenzeneboronic acid |
| CAS No |
16152-51-5 |
| Synonyms |
4-Cumylboronic acid; [4-(1-methylethyl)phenyl]boronic acid; 4-Isopropylphenylboronic acid; 4-Isoprophenylboronic Acid |
| Molecular Formula |
C9H13BO2 |
| Molecular Weight |
164.0093 |
| InChI |
InChI=1/C9H13BO2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7,11-12H,1-2H3 |
| Molecular Structure |
|
| Density |
1.04g/cm3 |
| Boiling point |
285.9°C at 760 mmHg |
| Refractive index |
1.513 |
| Flash point |
126.7°C |
| Vapour Pressur |
0.00127mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
