ChemNet > CAS > 1620-76-4 2-Cyano-4-methylpyridine
1620-76-4 2-Cyano-4-methylpyridine
| product Name |
2-Cyano-4-methylpyridine |
| CAS No |
1620-76-4 |
| Synonyms |
2-Cyano-4-picoline; 4-Methylpicolinonitrile; 4-Methyl-2-pyridinecarbonitrile; 4-methylpyridine-2-carbonitrile |
| Molecular Formula |
C7H6N2 |
| Molecular Weight |
118.1359 |
| InChI |
InChI=1/C7H6N2/c1-6-2-3-9-7(4-6)5-8/h2-4H,1H3 |
| EINECS |
244-131-3 |
| Molecular Structure |
|
| Density |
1.08g/cm3 |
| Boiling point |
261.1°C at 760 mmHg |
| Refractive index |
1.531 |
| Flash point |
99.9°C |
| Vapour Pressur |
0.0117mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
