16205-90-6 Ethyl 2-hexynoate
product Name |
Ethyl 2-hexynoate |
CAS No |
16205-90-6 |
Synonyms |
2-Hexynoic acid ethyl ester; ethyl hex-2-ynoate |
Molecular Formula |
C8H12O2 |
Molecular Weight |
140.1797 |
InChI |
InChI=1/C8H12O2/c1-3-5-6-7-8(9)10-4-2/h3-5H2,1-2H3 |
EINECS |
240-335-1 |
Molecular Structure |
|
Density |
0.951g/cm3 |
Boiling point |
205.1°C at 760 mmHg |
Refractive index |
1.44 |
Flash point |
76.9°C |
Vapour Pressur |
0.255mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|