ChemNet > CAS > 16207-83-3 stearic acid, compound with triethylamine (1:1)
16207-83-3 stearic acid, compound with triethylamine (1:1)
| product Name |
stearic acid, compound with triethylamine (1:1) |
| CAS No |
16207-83-3 |
| Synonyms |
Stearic acid, compound with triethylamine (1:1); octadecanoic acid - N,N-diethylethanamine (1:1) |
| Molecular Formula |
C24H51NO2 |
| Molecular Weight |
385.6672 |
| InChI |
InChI=1/C18H36O2.C6H15N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-7(5-2)6-3/h2-17H2,1H3,(H,19,20);4-6H2,1-3H3 |
| EINECS |
240-336-7 |
| Molecular Structure |
|
| Boiling point |
359.4°C at 760 mmHg |
| Flash point |
162.4°C |
| Vapour Pressur |
8.58E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
