ChemNet > CAS > 16208-17-6 4-Methoxyphenylglyoxal hydrate
16208-17-6 4-Methoxyphenylglyoxal hydrate
| product Name |
4-Methoxyphenylglyoxal hydrate |
| CAS No |
16208-17-6 |
| Synonyms |
4-methoxyphenylglyoxal hydrate, dry wt. Basis; 2,2-dihydroxy-1-(4-methoxyphenyl)ethanone |
| Molecular Formula |
C9H10O4 |
| Molecular Weight |
182.1733 |
| InChI |
InChI=1/C9H10O4/c1-13-7-4-2-6(3-5-7)8(10)9(11)12/h2-5,9,11-12H,1H3 |
| Molecular Structure |
|
| Density |
1.297g/cm3 |
| Boiling point |
335°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
136.2°C |
| Vapour Pressur |
4.85E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
