ChemNet > CAS > 162607-17-2 5-bromo-2-thienylboronic acid
162607-17-2 5-bromo-2-thienylboronic acid
| product Name |
5-bromo-2-thienylboronic acid |
| CAS No |
162607-17-2 |
| Synonyms |
5-Bromothiophene-2-boronic acid; (5-bromothiophen-2-yl)boronic acid; 5-Bromo-2-thiopheneboronic acid |
| Molecular Formula |
C4H4BBrO2S |
| Molecular Weight |
206.8534 |
| InChI |
InChI=1/C4H4BBrO2S/c6-4-2-1-3(9-4)5(7)8/h1-2,7-8H |
| Molecular Structure |
|
| Density |
1.87g/cm3 |
| Melting point |
130-135℃ |
| Boiling point |
342.3°C at 760 mmHg |
| Refractive index |
1.629 |
| Flash point |
160.8°C |
| Vapour Pressur |
2.93E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
