ChemNet > CAS > 162848-16-0 4-(1H-1,2,4-triazol-1-yl)benzoic acid
162848-16-0 4-(1H-1,2,4-triazol-1-yl)benzoic acid
| product Name |
4-(1H-1,2,4-triazol-1-yl)benzoic acid |
| CAS No |
162848-16-0 |
| Synonyms |
4-(1H-1,2,4-triazol-1-yl)benzoate |
| Molecular Formula |
C9H6N3O2 |
| Molecular Weight |
188.1634 |
| InChI |
InChI=1/C9H7N3O2/c13-9(14)7-1-3-8(4-2-7)12-6-10-5-11-12/h1-6H,(H,13,14)/p-1 |
| Molecular Structure |
|
| Melting point |
310℃ |
| Boiling point |
424.1°C at 760 mmHg |
| Flash point |
210.3°C |
| Vapour Pressur |
6E-08mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
