ChemNet > CAS > 16308-92-2 2,4-Dimethylbenzyl alcohol
16308-92-2 2,4-Dimethylbenzyl alcohol
| product Name |
2,4-Dimethylbenzyl alcohol |
| CAS No |
16308-92-2 |
| Molecular Formula |
C9H12O |
| Molecular Weight |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-3-4-9(6-10)8(2)5-7/h3-5,10H,6H2,1-2H3 |
| EINECS |
240-393-8 |
| Molecular Structure |
|
| Density |
1.002g/cm3 |
| Boiling point |
232°C at 760 mmHg |
| Refractive index |
1.536 |
| Flash point |
101.7°C |
| Vapour Pressur |
0.0337mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
