ChemNet > CAS > 16352-06-0 2-Amino-4-hydroxy-6-methyl-1,3,5-triazine
16352-06-0 2-Amino-4-hydroxy-6-methyl-1,3,5-triazine
| product Name |
2-Amino-4-hydroxy-6-methyl-1,3,5-triazine |
| Synonyms |
4-Amino-6-methyl-1,3,5-triazin-2(1H)-one; 4-Amino-6-methyl-1,3,5-triazin-2-ol; 4-amino-6-methyl-1,3,5-triazin-2(5H)-one |
| Molecular Formula |
C4H6N4O |
| Molecular Weight |
126.1166 |
| InChI |
InChI=1/C4H6N4O/c1-2-6-3(5)8-4(9)7-2/h1H3,(H3,5,6,7,8,9) |
| CAS Registry Number |
16352-06-0 |
| Molecular Structure |
|
| Density |
1.67g/cm3 |
| Melting point |
350℃ |
| Boiling point |
233.3°C at 760 mmHg |
| Refractive index |
1.731 |
| Flash point |
94.9°C |
| Vapour Pressur |
0.0564mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
2-Amino-4-hydroxy-6-methyl-1,3,5-triazine Material Safety Data Sheet
|
|
