ChemNet > CAS > 16382-15-3 Ethyl 5-methylindole-2-carboxylate
16382-15-3 Ethyl 5-methylindole-2-carboxylate
| product Name |
Ethyl 5-methylindole-2-carboxylate |
| CAS No |
16382-15-3 |
| Synonyms |
5-Methylindole-2-carboxylic acid ethyl ester; ethyl 5-methyl-1H-indole-2-carboxylate |
| Molecular Formula |
C12H13NO2 |
| Molecular Weight |
203.2371 |
| InChI |
InChI=1/C12H13NO2/c1-3-15-12(14)11-7-9-6-8(2)4-5-10(9)13-11/h4-7,13H,3H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.177g/cm3 |
| Boiling point |
356.5°C at 760 mmHg |
| Refractive index |
1.609 |
| Flash point |
169.4°C |
| Vapour Pressur |
2.9E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
