ChemNet > CAS > 16620-52-3 5-Methoxygramine
16620-52-3 5-Methoxygramine
| product Name |
5-Methoxygramine |
| CAS No |
16620-52-3 |
| Synonyms |
2-dimethylaminomethyl-5-methoxyindole; N-[(5-Methoxy-1H-indol-3-yl)methyl]-N,N-dimethylamine; 1-(5-methoxy-1H-indol-3-yl)-N,N-dimethylmethanamine; (5-methoxy-1H-indol-3-yl)-N,N-dimethylmethanaminium |
| Molecular Formula |
C12H17N2O |
| Molecular Weight |
205.2756 |
| InChI |
InChI=1/C12H16N2O/c1-14(2)8-9-7-13-12-5-4-10(15-3)6-11(9)12/h4-7,13H,8H2,1-3H3/p+1 |
| EINECS |
240-669-8 |
| Molecular Structure |
|
| Melting point |
125-127℃ |
| Boiling point |
334.7°C at 760 mmHg |
| Flash point |
156.2°C |
| Vapour Pressur |
0.000126mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
