ChemNet > CAS > 1664-54-6 3-Aminophenylpropanoic Acid
1664-54-6 3-Aminophenylpropanoic Acid
| product Name |
3-Aminophenylpropanoic Acid |
| CAS No |
1664-54-6 |
| Synonyms |
3-(3-Aminophenyl)propionic acid; 3-amino-3-phenylpropanoic acid; 3-(3-aminophenyl)propanoic acid |
| Molecular Formula |
C9H11NO2 |
| Molecular Weight |
165.1891 |
| InChI |
InChI=1/C9H11NO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6H,4-5,10H2,(H,11,12) |
| EINECS |
210-371-2 |
| Molecular Structure |
|
| Density |
1.217g/cm3 |
| Boiling point |
356.2°C at 760 mmHg |
| Refractive index |
1.597 |
| Flash point |
169.2°C |
| Vapour Pressur |
1.09E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
