ChemNet > CAS > 16649-49-3 (Acetic anhydride)-d6
16649-49-3 (Acetic anhydride)-d6
| product Name |
(Acetic anhydride)-d6 |
| CAS No |
16649-49-3 |
| Synonyms |
(2H3)Acetic anhydride; (~2~H_3_)ethanoic anhydride |
| Molecular Formula |
C4D6O3 |
| Molecular Weight |
108.1256 |
| InChI |
InChI=1/C4H6O3/c1-3(5)7-4(2)6/h1-2H3/i1D3,2D3 |
| EINECS |
240-697-0 |
| Molecular Structure |
|
| Density |
1.136g/cm3 |
| Boiling point |
141.1°C at 760 mmHg |
| Refractive index |
1.386 |
| Flash point |
54.4°C |
| Vapour Pressur |
5.94mmHg at 25°C |
| Hazard Symbols |
 C:Corrosive;
|
| Risk Codes |
R10:Flammable.;
R20/22:Harmful by inhalation and if swallowed.;
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
