ChemNet > CAS > 1667-00-1 Cyclopropylphenylmethane
1667-00-1 Cyclopropylphenylmethane
| product Name |
Cyclopropylphenylmethane |
| CAS No |
1667-00-1 |
| Synonyms |
benzylcyclopropane; (cyclopropylmethyl)benzene |
| Molecular Formula |
C10H12 |
| Molecular Weight |
132.2023 |
| InChI |
InChI=1/C10H12/c1-2-4-9(5-3-1)8-10-6-7-10/h1-5,10H,6-8H2 |
| EINECS |
216-782-3 |
| Molecular Structure |
|
| Density |
1.005g/cm3 |
| Boiling point |
189.7°C at 760 mmHg |
| Refractive index |
1.567 |
| Flash point |
59.1°C |
| Vapour Pressur |
0.777mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
