ChemNet > CAS > 166744-78-1 4-Benzyloxy-2-fluorobenzeneboronic acid
166744-78-1 4-Benzyloxy-2-fluorobenzeneboronic acid
| product Name |
4-Benzyloxy-2-fluorobenzeneboronic acid |
| CAS No |
166744-78-1 |
| Synonyms |
4-Benzyloxy-2-fluorophenylboronic acid |
| Molecular Formula |
C13H12BFO3 |
| Molecular Weight |
246.042 |
| InChI |
InChI=1/C13H12BFO3/c15-13-8-11(6-7-12(13)14(16)17)18-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2 |
| Molecular Structure |
|
| Density |
1.26g/cm3 |
| Melting point |
153℃ |
| Boiling point |
406.8°C at 760 mmHg |
| Refractive index |
1.577 |
| Flash point |
199.8°C |
| Vapour Pressur |
2.4E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
