ChemNet > CAS > 16689-02-4 5-Nitrothiophene-2-carbonitrile
16689-02-4 5-Nitrothiophene-2-carbonitrile
| product Name |
5-Nitrothiophene-2-carbonitrile |
| CAS No |
16689-02-4 |
| Synonyms |
2-Cyano-5-nitrothiophene |
| Molecular Formula |
C5H2N2O2S |
| Molecular Weight |
154.1466 |
| InChI |
InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| Molecular Structure |
|
| Density |
1.5g/cm3 |
| Boiling point |
273.9°C at 760 mmHg |
| Refractive index |
1.611 |
| Flash point |
119.4°C |
| Vapour Pressur |
0.00558mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
