ChemNet > CAS > 16703-52-9 Ethyl NN-Dimethyloxamate
16703-52-9 Ethyl NN-Dimethyloxamate
| product Name |
Ethyl NN-Dimethyloxamate |
| CAS No |
16703-52-9 |
| Synonyms |
Ethyl N,N-dimethyloxamate; N,N-Dimethyloxamic acid ethyl ester; ethyl (dimethylamino)(oxo)acetate; Ethyl-N,N-dimethyl oxamate |
| Molecular Formula |
C6H11NO3 |
| Molecular Weight |
145.1564 |
| InChI |
InChI=1/C6H11NO3/c1-4-10-6(9)5(8)7(2)3/h4H2,1-3H3 |
| EINECS |
240-755-5 |
| Molecular Structure |
|
| Density |
1.071g/cm3 |
| Boiling point |
176.6°C at 760 mmHg |
| Refractive index |
1.435 |
| Flash point |
60.6°C |
| Vapour Pressur |
1.09mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
