ChemNet > CAS > 16713-66-9 3,3-Tetramethyleneglutaric acid
16713-66-9 3,3-Tetramethyleneglutaric acid
| product Name |
3,3-Tetramethyleneglutaric acid |
| CAS No |
16713-66-9 |
| Synonyms |
Cyclopentane-1,1-diacetic acid; 1,1-cyclopentanediacetic acid; 2,2'-cyclopentane-1,1-diyldiacetic acid; 2,2'-cyclopentane-1,1-diyldiacetate |
| Molecular Formula |
C9H12O4 |
| Molecular Weight |
184.1903 |
| InChI |
InChI=1/C9H14O4/c10-7(11)5-9(6-8(12)13)3-1-2-4-9/h1-6H2,(H,10,11)(H,12,13)/p-2 |
| EINECS |
240-761-8 |
| Molecular Structure |
|
| Melting point |
180-181℃ |
| Boiling point |
396.2°C at 760 mmHg |
| Flash point |
207.6°C |
| Vapour Pressur |
2.21E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
