ChemNet > CAS > 16718-11-9 3-(Phenylthio)thiophene
16718-11-9 3-(Phenylthio)thiophene
| product Name |
3-(Phenylthio)thiophene |
| CAS No |
16718-11-9 |
| Synonyms |
Phenyl 3-thienyl sulphide; 3-(phenylsulfanyl)thiophene |
| Molecular Formula |
C10H8S2 |
| Molecular Weight |
192.3005 |
| InChI |
InChI=1/C10H8S2/c1-2-4-9(5-3-1)12-10-6-7-11-8-10/h1-8H |
| Molecular Structure |
|
| Density |
1.24g/cm3 |
| Boiling point |
304.7°C at 760 mmHg |
| Refractive index |
1.667 |
| Flash point |
138.1°C |
| Vapour Pressur |
0.00155mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
