ChemNet > CAS > 167415-27-2 1-Bromo-2,5-difluoro-4-nitrobenzene
167415-27-2 1-Bromo-2,5-difluoro-4-nitrobenzene
| product Name |
1-Bromo-2,5-difluoro-4-nitrobenzene |
| CAS No |
167415-27-2 |
| Synonyms |
4-Bromo-2,5-difluoronitrobenzene |
| Molecular Formula |
C6H2BrF2NO2 |
| Molecular Weight |
237.9864 |
| InChI |
InChI=1/C6H2BrF2NO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H |
| Molecular Structure |
|
| Density |
1.89g/cm3 |
| Boiling point |
262.4°C at 760 mmHg |
| Refractive index |
1.556 |
| Flash point |
112.5°C |
| Vapour Pressur |
0.0178mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
