ChemNet > CAS > 1677-46-9 4-hydroxy-1-methyl-2(1H)quinolone
1677-46-9 4-hydroxy-1-methyl-2(1H)quinolone
| product Name |
4-hydroxy-1-methyl-2(1H)quinolone |
| CAS No |
1677-46-9 |
| Synonyms |
4-Hydroxy-1-methyl-2(1H)-quinolone; 4-Hydroxy-1-methyl-2-quinolone; 4-Hydroxy-1-Metyl-2-(1H)Quinolone; 4-Hydroxy-1-methyl-1,2-dihydroquinolin-2-one; 2-hydroxy-1-methylquinolin-4(1H)-one; 4-hydroxy-1-methylquinolin-2(1H)-one |
| Molecular Formula |
C10H9NO2 |
| Molecular Weight |
175.184 |
| InChI |
InChI=1/C10H9NO2/c1-11-8-5-3-2-4-7(8)9(12)6-10(11)13/h2-6,12H,1H3 |
| EINECS |
216-830-3 |
| Molecular Structure |
|
| Density |
1.326g/cm3 |
| Melting point |
269-271℃ |
| Boiling point |
297.555°C at 760 mmHg |
| Refractive index |
1.647 |
| Flash point |
133.756°C |
| Vapour Pressur |
0.001mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
