ChemNet > CAS > 16932-49-3 2,6-Dimethoxybenzonitrile
16932-49-3 2,6-Dimethoxybenzonitrile
| product Name |
2,6-Dimethoxybenzonitrile |
| CAS No |
16932-49-3 |
| Synonyms |
Benzonitrile, 2,6-dimethoxy-; 2-10-00-00260 (Beilstein Handbook Reference); BRN 2720059 |
| Molecular Formula |
C9H9NO2 |
| Molecular Weight |
163.1733 |
| InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5H,1-2H3 |
| EINECS |
241-000-2 |
| Molecular Structure |
|
| Density |
1.12g/cm3 |
| Melting point |
119-123℃ |
| Boiling point |
306.7°C at 760 mmHg |
| Refractive index |
1.519 |
| Flash point |
128.8°C |
| Vapour Pressur |
0.000758mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
