ChemNet > CAS > 16954-74-8 2-(Dicyanomethylene)indane-1,3-dione
16954-74-8 2-(Dicyanomethylene)indane-1,3-dione
| product Name |
2-(Dicyanomethylene)indane-1,3-dione |
| CAS No |
16954-74-8 |
| Synonyms |
(1,3-Dioxo-1,3-dihydro-2H-inden-2-ylidene)malononitrile; 2-(Dicyanomethylene)indan-1,3-dione; 2-(Dicyanomethylene)indene-1,3-dione; Propanedinitrile, (1,3-dihydro-1,3-dioxo-2H-inden-2-ylidene)-; Propanedinitrile, 2-(1,3-dihydro-1,3-dioxo-2H-inden-2-ylidene)-; (1,3-dioxo-1,3-dihydro-2H-inden-2-ylidene)propanedinitrile |
| Molecular Formula |
C12H4N2O2 |
| Molecular Weight |
208.1724 |
| InChI |
InChI=1/C12H4N2O2/c13-5-7(6-14)10-11(15)8-3-1-2-4-9(8)12(10)16/h1-4H |
| Molecular Structure |
|
| Density |
1.485g/cm3 |
| Boiling point |
347.9°C at 760 mmHg |
| Refractive index |
1.664 |
| Flash point |
164.2°C |
| Vapour Pressur |
5.2E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
