ChemNet > CAS > 1696-17-9 N,N-Diethylbenzamide
1696-17-9 N,N-Diethylbenzamide
| product Name |
N,N-Diethylbenzamide |
| CAS No |
1696-17-9 |
| Synonyms |
Rebemide; 4-09-00-00728 (Beilstein Handbook Reference); AI3-01197; BRN 1909505; Benzoic acid N,N-diethylamide; Benzoic acid diethylamide; Benzoyldiethylamine; NSC 16060; R 2; R 2 (VAN); R 2 (insect repellant); R 2 (insect repellent); R2; REP; Rebemid; Benzamide, N,N-diethyl- |
| Molecular Formula |
C11H15NO |
| Molecular Weight |
177.2429 |
| InChI |
InChI=1/C11H15NO/c1-3-12(4-2)11(13)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| EINECS |
216-912-9 |
| Molecular Structure |
|
| Density |
0.997g/cm3 |
| Boiling point |
288.7°C at 760 mmHg |
| Refractive index |
1.518 |
| Flash point |
125.5°C |
| Vapour Pressur |
0.0023mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R21/22:Harmful in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
