ChemNet > CAS > 1698-53-9 1-Phenyl-4,5-dichloro-6-pyridazone
1698-53-9 1-Phenyl-4,5-dichloro-6-pyridazone
| product Name |
1-Phenyl-4,5-dichloro-6-pyridazone |
| CAS No |
1698-53-9 |
| Synonyms |
4,5-dichloro-2,3-dihydro-2-phenylpyridazin-3-one; 4,5-Dichloro-2-phenylpyridazin-3(2H)one; 4,5-dichloro-2-phenyl-2,3-dihydropyridazin-3-one; 4-oxo-7-(trifluoromethyl)-1,4-dihydroquinoline-3-carboxylic acid; 4,5-dichloropyridazin-3(2H)-one |
| Molecular Formula |
C4H2Cl2N2O |
| Molecular Weight |
164.9775 |
| InChI |
InChI=1/C4H2Cl2N2O/c5-2-1-7-8-4(9)3(2)6/h1H,(H,8,9) |
| EINECS |
216-917-6 |
| Molecular Structure |
|
| Density |
1.76g/cm3 |
| Melting point |
164-166℃ |
| Boiling point |
339.2°C at 760 mmHg |
| Refractive index |
1.661 |
| Flash point |
159°C |
| Vapour Pressur |
4.74E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
