ChemNet > CAS > 1700-30-7 3-Benzyloxybenzyl alcohol
1700-30-7 3-Benzyloxybenzyl alcohol
| product Name |
3-Benzyloxybenzyl alcohol |
| CAS No |
1700-30-7 |
| Synonyms |
[3-(benzyloxy)phenyl]methanol; [3-(benzyloxy)phenyl]acetonitrile |
| Molecular Formula |
C15H13NO |
| Molecular Weight |
223.2698 |
| InChI |
InChI=1/C15H13NO/c16-10-9-13-7-4-8-15(11-13)17-12-14-5-2-1-3-6-14/h1-8,11H,9,12H2 |
| EINECS |
216-931-2 |
| Molecular Structure |
|
| Density |
1.114g/cm3 |
| Melting point |
47-52℃ |
| Boiling point |
387°C at 760 mmHg |
| Refractive index |
1.582 |
| Flash point |
162.9°C |
| Vapour Pressur |
3.39E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
