ChemNet > CAS > 170572-49-3 3-Fluoro-4-methylbenzonitrile
170572-49-3 3-Fluoro-4-methylbenzonitrile
| product Name |
3-Fluoro-4-methylbenzonitrile |
| CAS No |
170572-49-3 |
| Synonyms |
4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
| Molecular Formula |
C8H6FN |
| Molecular Weight |
135.1383 |
| InChI |
InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
| Molecular Structure |
|
| Density |
1.117g/cm3 |
| Melting point |
48-50℃ |
| Boiling point |
215.069°C at 760 mmHg |
| Refractive index |
1.508 |
| Flash point |
90.3°C |
| Vapour Pressur |
0.151mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
