ChemNet > CAS > 170918-42-0 (R)-Phenyl superquat
170918-42-0 (R)-Phenyl superquat
| product Name |
(R)-Phenyl superquat |
| CAS No |
170918-42-0 |
| Synonyms |
(R)-5,5-Dimethyl-4-phenyl-2-oxazolidinone; (4R)-5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one |
| Molecular Formula |
C11H13NO2 |
| Molecular Weight |
191.2264 |
| InChI |
InChI=1/C11H13NO2/c1-11(2)9(12-10(13)14-11)8-6-4-3-5-7-8/h3-7,9H,1-2H3,(H,12,13)/t9-/m1/s1 |
| Molecular Structure |
|
| Density |
1.093g/cm3 |
| Melting point |
155-159℃ |
| Boiling point |
383.2°C at 760 mmHg |
| Refractive index |
1.514 |
| Flash point |
185.6°C |
| Vapour Pressur |
4.47E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
