ChemNet > CAS > 1711-10-0 3-iodobenzoyl chloride
1711-10-0 3-iodobenzoyl chloride
| product Name |
3-iodobenzoyl chloride |
| CAS No |
1711-10-0 |
| Molecular Formula |
C7H4ClIO |
| Molecular Weight |
266.46 |
| InChI |
InChI=1/C7H4ClIO/c8-7(10)5-2-1-3-6(9)4-5/h1-4H |
| EINECS |
216-979-4 |
| Molecular Structure |
|
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
