17136-36-6 N-Benzylglycine
product Name |
N-Benzylglycine |
CAS No |
17136-36-6 |
Synonyms |
Benzyl Glycine; 2-(benzylamino)acetic acid |
Molecular Formula |
C9H11NO2 |
Molecular Weight |
165.1891 |
InChI |
InChI=1/C9H11NO2/c11-9(12)7-10-6-8-4-2-1-3-5-8/h1-5,10H,6-7H2,(H,11,12) |
EINECS |
241-194-9 |
Molecular Structure |
|
Density |
1.161g/cm3 |
Boiling point |
308.9°C at 760 mmHg |
Refractive index |
1.554 |
Flash point |
140.6°C |
Vapour Pressur |
0.000285mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|