ChemNet > CAS > 17138-28-2 Ethyl 4-hydroxyphenylacetate
17138-28-2 Ethyl 4-hydroxyphenylacetate
| product Name |
Ethyl 4-hydroxyphenylacetate |
| CAS No |
17138-28-2 |
| Synonyms |
4-Hydroxyphenylacetic acid ethyl ester |
| Molecular Formula |
C10H12O3 |
| Molecular Weight |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-2-13-10(12)7-8-3-5-9(11)6-4-8/h3-6,11H,2,7H2,1H3 |
| EINECS |
241-197-5 |
| Molecular Structure |
|
| Density |
1.146g/cm3 |
| Boiling point |
290.8°C at 760 mmHg |
| Refractive index |
1.532 |
| Flash point |
122.7°C |
| Vapour Pressur |
0.00116mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
