ChemNet > CAS > 1719-06-8 Anthracene-d10
1719-06-8 Anthracene-d10
| product Name |
Anthracene-d10 |
| CAS No |
1719-06-8 |
| Synonyms |
(2H10)Anthracene; Perdeuterioanthracene; (~2~H_10_)anthracene |
| Molecular Formula |
C14D10 |
| Molecular Weight |
188.2908 |
| InChI |
InChI=1/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| EINECS |
217-004-5 |
| Molecular Structure |
|
| Density |
1.194g/cm3 |
| Melting point |
218-220℃ |
| Boiling point |
337.4°C at 760 mmHg |
| Refractive index |
1.714 |
| Flash point |
146.6°C |
| Vapour Pressur |
0.000206mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
