ChemNet > CAS > 1720-32-7 1,6-Diphenyl-1,3,5-hexatriene
1720-32-7 1,6-Diphenyl-1,3,5-hexatriene
| product Name |
1,6-Diphenyl-1,3,5-hexatriene |
| CAS No |
1720-32-7 |
| Synonyms |
DPH; 1,1'-hexa-1,3,5-triene-1,6-diyldibenzene; 1,1'-(1E,3E,5E)-hexa-1,3,5-triene-1,6-diyldibenzene; 1-phenylhexa-1,3,5-trienylbenzene |
| Molecular Formula |
C18H16 |
| Molecular Weight |
232.3196 |
| InChI |
InChI=1/C18H16/c1-2-3-6-15-18(16-11-7-4-8-12-16)17-13-9-5-10-14-17/h2-15H,1H2 |
| EINECS |
217-011-3 |
| Molecular Structure |
|
| Density |
0.988g/cm3 |
| Melting point |
199-203℃ |
| Boiling point |
361°C at 760 mmHg |
| Refractive index |
1.585 |
| Flash point |
185.3°C |
| Vapour Pressur |
4.44E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
