ChemNet > CAS > 17216-08-9 2-Acetyl-1-tetralone
17216-08-9 2-Acetyl-1-tetralone
| product Name |
2-Acetyl-1-tetralone |
| CAS No |
17216-08-9 |
| Synonyms |
2-acetyl-1,2,3,4-tetrahydronaphthalen-1-one; 2-acetyl-3,4-dihydronaphthalen-1(2H)-one; 1-(1-hydroxy-3,4-dihydronaphthalen-2-yl)ethanone |
| Molecular Formula |
C12H12O2 |
| Molecular Weight |
188.2225 |
| InChI |
InChI=1/C12H12O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-5,14H,6-7H2,1H3 |
| EINECS |
241-259-1 |
| Molecular Structure |
|
| Density |
1.223g/cm3 |
| Melting point |
55-57℃ |
| Boiling point |
359.4°C at 760 mmHg |
| Refractive index |
1.611 |
| Flash point |
153.3°C |
| Vapour Pressur |
8.59E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
