ChemNet > CAS > 1722-10-7 3-Chloro-6-methoxypyridazine
1722-10-7 3-Chloro-6-methoxypyridazine
| product Name |
3-Chloro-6-methoxypyridazine |
| CAS No |
1722-10-7 |
| Molecular Formula |
C5H5ClN2O |
| Molecular Weight |
144.559 |
| InChI |
InChI=1/C5H5ClN2O/c1-9-5-3-2-4(6)7-8-5/h2-3H,1H3 |
| EINECS |
217-019-7 |
| Molecular Structure |
|
| Density |
1.292g/cm3 |
| Melting point |
85-92℃ |
| Boiling point |
284.9°C at 760 mmHg |
| Refractive index |
1.52 |
| Flash point |
126.1°C |
| Vapour Pressur |
0.00498mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
