ChemNet > CAS > 17249-79-5 2,3-Dichlorothiophene
17249-79-5 2,3-Dichlorothiophene
| product Name |
2,3-Dichlorothiophene |
| CAS No |
17249-79-5;17249-29-5 |
| Synonyms |
2,3-dichloro-thiophene |
| Molecular Formula |
C4H2Cl2S |
| Molecular Weight |
153.0297 |
| InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
| Molecular Structure |
|
| Density |
1.488g/cm3 |
| Melting point |
-26℃ |
| Boiling point |
170.7°C at 760 mmHg |
| Refractive index |
1.584 |
| Flash point |
68.9°C |
| Vapour Pressur |
1.93mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
