ChemNet > CAS > 1726-12-1 1,1-Diphenylpentane
1726-12-1 1,1-Diphenylpentane
| product Name |
1,1-Diphenylpentane |
| CAS No |
1726-12-1 |
| Synonyms |
1,1'-pentane-1,1-diyldibenzene |
| Molecular Formula |
C17H20 |
| Molecular Weight |
224.3407 |
| InChI |
InChI=1/C17H20/c1-2-3-14-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17H,2-3,14H2,1H3 |
| Molecular Structure |
|
| Density |
0.952g/cm3 |
| Boiling point |
308°C at 760 mmHg |
| Refractive index |
1.541 |
| Flash point |
149.7°C |
| Vapour Pressur |
0.00127mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
