1726-12-1 1,1-Diphenylpentane
product Name |
1,1-Diphenylpentane |
CAS No |
1726-12-1 |
Synonyms |
1,1'-pentane-1,1-diyldibenzene |
Molecular Formula |
C17H20 |
Molecular Weight |
224.3407 |
InChI |
InChI=1/C17H20/c1-2-3-14-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17H,2-3,14H2,1H3 |
Molecular Structure |
|
Density |
0.952g/cm3 |
Boiling point |
308°C at 760 mmHg |
Refractive index |
1.541 |
Flash point |
149.7°C |
Vapour Pressur |
0.00127mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|